(S)-3-aminocarbonyl-2-hydroxypropanoic acid

🙚 Home 🙚 Tables for Chemistry 🙘 Compound classes 🙘

(S)-3-aminocarbonyl-2-hydroxypropanoic acid; L-β-malamidic acid
Formula:C4H7NO4; 133.10 g/mol
InChiKey:RTTYFXMXRFYCHM-REOHCLBHSA-N
SMILES:NC(=O)C[C@H](O)C(O)=O
Molecular structure of (S)-3-aminocarbonyl-2-hydroxypropanoic acid

Isomers

(S)-3-aminocarbonyl-2-hydroxypropanoic acid
Molecular structure of (S)-3-aminocarbonyl-2-hydroxypropanoic acid
4-amino-2-hydroxy-4-oxobutanoic acid
Molecular structure of 4-amino-2-hydroxy-4-oxobutanoic acid
2-amino-2-methylmalonic acid
Molecular structure of 2-amino-2-methylmalonic acid
D-aspartic acid
Molecular structure of D-aspartic acid
DL-aspartic acid
Molecular structure of DL-aspartic acid
L-aspartic acid
Molecular structure of L-aspartic acid
2-(carboxymethylamino)acetic acid
Molecular structure of 2-(carboxymethylamino)acetic acid
ethyl nitroacetate
Molecular structure of ethyl nitroacetate
ethyl 2-nitroacetate
Molecular structure of ethyl 2-nitroacetate
  ::